C15H22N2O3 — CID 103950113
(2S)-2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanamide (PubChem CID 103950113) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanamide.
| Compound Name | (2S)-2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanamide |
|---|---|
| PubChem CID | 103950113 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2S)-2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanamide |
| SMILES | CCCC[C@H](N)C(=O)Nc1ccc2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C15H22N2O3/c1-4-5-6-11(16)14(18)17-10-7-8-12-13(9-10)20-15(2,3)19-12/h7-9,11H,4-6,16H2,1-3H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | NUOKHRNIYHLIBU-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |