C16H26N2O3 — CID 103830950
(2S)-2-amino-N-(3,4-diethoxyphenyl)hexanamide (PubChem CID 103830950) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-diethoxyphenyl)hexanamide.
| Compound Name | (2S)-2-amino-N-(3,4-diethoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 103830950 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2S)-2-amino-N-(3,4-diethoxyphenyl)hexanamide |
| SMILES | CCCC[C@H](N)C(=O)Nc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-7-8-13(17)16(19)18-12-9-10-14(20-5-2)15(11-12)21-6-3/h9-11,13H,4-8,17H2,1-3H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | CRLBQFOSIJCNQK-ZDUSSCGKSA-N |
| XLogP | 2.94 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |