C14H23ClN2O3S — CID 119286170
(2S)-2-amino-N-(3-ethoxy-4-methoxyphenyl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119286170) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-ethoxy-4-methoxyphenyl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(3-ethoxy-4-methoxyphenyl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119286170 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2S)-2-amino-N-(3-ethoxy-4-methoxyphenyl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CCOc1cc(NC(=O)[C@@H](N)CCSC)ccc1OC.Cl |
| InChI | InChI=1S/C14H22N2O3S.ClH/c1-4-19-13-9-10(5-6-12(13)18-2)16-14(17)11(15)7-8-20-3;/h5-6,9,11H,4,7-8,15H2,1-3H3,(H,16,17);1H/t11-;/m0./s1 |
| InChIKey | AHFSUOMYJNSJSH-MERQFXBCSA-N |
| XLogP | 2.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |