C12H14F2N2O3 — CID 24702400
2-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylbutanamide (PubChem CID 24702400) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 24702400 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H14F2N2O3/c1-6(2)10(15)11(17)16-7-3-4-8-9(5-7)19-12(13,14)18-8/h3-6,10H,15H2,1-2H3,(H,16,17) |
| InChIKey | UDOAIAQIGWNBKQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |