C11H11F2NO5S — CID 51080513
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylsulfonylpropanamide (PubChem CID 51080513) has the molecular formula C11H11F2NO5S and a molecular weight of 307.27 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylsulfonylpropanamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 51080513 |
| Molecular Formula | C11H11F2NO5S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1ccc2c(c1)OC(F)(F)O2)S(C)(=O)=O |
| InChI | InChI=1S/C11H11F2NO5S/c1-6(20(2,16)17)10(15)14-7-3-4-8-9(5-7)19-11(12,13)18-8/h3-6H,1-2H3,(H,14,15) |
| InChIKey | PBGLUZFCYNYXST-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |