C15H11F2NO5S — CID 26954321
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methylsulfonylbenzamide (PubChem CID 26954321) has the molecular formula C15H11F2NO5S and a molecular weight of 355.32 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methylsulfonylbenzamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 26954321 |
| Molecular Formula | C15H11F2NO5S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C15H11F2NO5S/c1-24(20,21)11-5-2-9(3-6-11)14(19)18-10-4-7-12-13(8-10)23-15(16,17)22-12/h2-8H,1H3,(H,18,19) |
| InChIKey | XMKQCSIRKMITPU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |