C15H12F2N2O5S — CID 8841631
N-[4-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]phenyl]acetamide (PubChem CID 8841631) has the molecular formula C15H12F2N2O5S and a molecular weight of 370.33 g/mol. Its IUPAC name is N-[4-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8841631 |
| Molecular Formula | C15H12F2N2O5S |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[4-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C15H12F2N2O5S/c1-9(20)18-10-2-5-12(6-3-10)25(21,22)19-11-4-7-13-14(8-11)24-15(16,17)23-13/h2-8,19H,1H3,(H,18,20) |
| InChIKey | OTKNYKSIZIAMSZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |