C13H8ClF2NO4S — CID 8841662
2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzenesulfonamide (PubChem CID 8841662) has the molecular formula C13H8ClF2NO4S and a molecular weight of 347.73 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 8841662 |
| Molecular Formula | C13H8ClF2NO4S |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OC(F)(F)O2)c1ccccc1Cl |
| InChI | InChI=1S/C13H8ClF2NO4S/c14-9-3-1-2-4-12(9)22(18,19)17-8-5-6-10-11(7-8)21-13(15,16)20-10/h1-7,17H |
| InChIKey | KLJMSLZCICXITG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |