C14H8ClF2NO6S — CID 25331541
2-chloro-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]benzoic acid (PubChem CID 25331541) has the molecular formula C14H8ClF2NO6S and a molecular weight of 391.74 g/mol. Its IUPAC name is 2-chloro-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 25331541 |
| Molecular Formula | C14H8ClF2NO6S |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 2-chloro-5-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc3c(c2)OC(F)(F)O3)ccc1Cl |
| InChI | InChI=1S/C14H8ClF2NO6S/c15-10-3-2-8(6-9(10)13(19)20)25(21,22)18-7-1-4-11-12(5-7)24-14(16,17)23-11/h1-6,18H,(H,19,20) |
| InChIKey | HQRPZOARWUNUHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |