C13H9ClN2O3S — CID 110728981
N-(1,3-benzoxazol-6-yl)-2-chlorobenzenesulfonamide (PubChem CID 110728981) has the molecular formula C13H9ClN2O3S and a molecular weight of 308.75 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-yl)-2-chlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzoxazol-6-yl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 110728981 |
| Molecular Formula | C13H9ClN2O3S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | N-(1,3-benzoxazol-6-yl)-2-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2ncoc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C13H9ClN2O3S/c14-10-3-1-2-4-13(10)20(17,18)16-9-5-6-11-12(7-9)19-8-15-11/h1-8,16H |
| InChIKey | DMNOQPZVLMLEFD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |