C15H11N3O4S — CID 110728971
N-(1,3-benzoxazol-6-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110728971) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(1,3-benzoxazol-6-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110728971 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(1,3-benzoxazol-6-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)Nc3ccc4ncoc4c3)ccc2N1 |
| InChI | InChI=1S/C15H11N3O4S/c19-15-6-9-5-11(2-4-12(9)17-15)23(20,21)18-10-1-3-13-14(7-10)22-8-16-13/h1-5,7-8,18H,6H2,(H,17,19) |
| InChIKey | UASKALMYQADZDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |