C17H18N2O4S — CID 110728969
N-(1,3-benzoxazol-6-yl)-4-ethoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 110728969) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-yl)-4-ethoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(1,3-benzoxazol-6-yl)-4-ethoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110728969 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(1,3-benzoxazol-6-yl)-4-ethoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | CCOc1cc(C)c(S(=O)(=O)Nc2ccc3ncoc3c2)cc1C |
| InChI | InChI=1S/C17H18N2O4S/c1-4-22-15-7-12(3)17(8-11(15)2)24(20,21)19-13-5-6-14-16(9-13)23-10-18-14/h5-10,19H,4H2,1-3H3 |
| InChIKey | MPBNCPPSIGKHCE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |