C17H21NO5S — CID 39845568
2,5-diethoxy-N-(2-hydroxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 39845568) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 2,5-diethoxy-N-(2-hydroxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-diethoxy-N-(2-hydroxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39845568 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2,5-diethoxy-N-(2-hydroxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | CCOc1cc(S(=O)(=O)Nc2ccccc2O)c(OCC)cc1C |
| InChI | InChI=1S/C17H21NO5S/c1-4-22-15-11-17(16(23-5-2)10-12(15)3)24(20,21)18-13-8-6-7-9-14(13)19/h6-11,18-19H,4-5H2,1-3H3 |
| InChIKey | UUDVSRXGXUFJAR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|