C13H8F2N2O3 — CID 571626
N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-3-carboxamide (PubChem CID 571626) has the molecular formula C13H8F2N2O3 and a molecular weight of 278.21 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-3-carboxamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 571626 |
| Molecular Formula | C13H8F2N2O3 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)c1cccnc1 |
| InChI | InChI=1S/C13H8F2N2O3/c14-13(15)19-10-4-3-9(6-11(10)20-13)17-12(18)8-2-1-5-16-7-8/h1-7H,(H,17,18) |
| InChIKey | PHLCOAFKSPJKII-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |