C11H7F2N3O3 — CID 47177474
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxamide (PubChem CID 47177474) has the molecular formula C11H7F2N3O3 and a molecular weight of 267.19 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47177474 |
| Molecular Formula | C11H7F2N3O3 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)c1ccn[nH]1 |
| InChI | InChI=1S/C11H7F2N3O3/c12-11(13)18-8-2-1-6(5-9(8)19-11)15-10(17)7-3-4-14-16-7/h1-5H,(H,14,16)(H,15,17) |
| InChIKey | MCPZBYRPCVYITI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |