C13H7BrF2N2O3 — CID 103752062
2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-4-carboxamide (PubChem CID 103752062) has the molecular formula C13H7BrF2N2O3 and a molecular weight of 357.11 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103752062 |
| Molecular Formula | C13H7BrF2N2O3 |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)c1ccnc(Br)c1 |
| InChI | InChI=1S/C13H7BrF2N2O3/c14-11-5-7(3-4-17-11)12(19)18-8-1-2-9-10(6-8)21-13(15,16)20-9/h1-6H,(H,18,19) |
| InChIKey | HQNLMPQQBQZSSR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|