C17H16F2N2O6S — CID 24625442
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 24625442) has the molecular formula C17H16F2N2O6S and a molecular weight of 414.39 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24625442 |
| Molecular Formula | C17H16F2N2O6S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C17H16F2N2O6S/c1-25-9-8-20-28(23,24)13-5-2-11(3-6-13)16(22)21-12-4-7-14-15(10-12)27-17(18,19)26-14/h2-7,10,20H,8-9H2,1H3,(H,21,22) |
| InChIKey | KKVLTTBBHRUXRY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|