C23H24N2O5S — CID 24584227
4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide (PubChem CID 24584227) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 24584227 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(Oc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-17-3-9-20(10-4-17)30-21-11-7-19(8-12-21)25-23(26)18-5-13-22(14-6-18)31(27,28)24-15-16-29-2/h3-14,24H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | TWHWKJVNOSQXKE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|