C19H24N4O5S — CID 55490440
N-(2-methoxyethyl)-4-[[[2-(4-methylanilino)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 55490440) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[[2-(4-methylanilino)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-[[[2-(4-methylanilino)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55490440 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[[2-(4-methylanilino)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NNC(=O)CNc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O5S/c1-14-3-7-16(8-4-14)20-13-18(24)22-23-19(25)15-5-9-17(10-6-15)29(26,27)21-11-12-28-2/h3-10,20-21H,11-13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | GMFBGGUFFFXETN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|