C17H19N3O4S — CID 55350628
N'-[2-(4-methylanilino)acetyl]-3-methylsulfonylbenzohydrazide (PubChem CID 55350628) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N'-[2-(4-methylanilino)acetyl]-3-methylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(4-methylanilino)acetyl]-3-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 55350628 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N'-[2-(4-methylanilino)acetyl]-3-methylsulfonylbenzohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-12-6-8-14(9-7-12)18-11-16(21)19-20-17(22)13-4-3-5-15(10-13)25(2,23)24/h3-10,18H,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | BAVZQGGHBBCPMS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|