C24H25N3O5S — CID 27569057
3-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 27569057) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 3-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 3-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 27569057 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)COc3cc(C)ccc3C)c2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-16-8-11-20(12-9-16)27-33(30,31)21-6-4-5-19(14-21)24(29)26-25-23(28)15-32-22-13-17(2)7-10-18(22)3/h4-14,27H,15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | AHGSDFWFOBOPKM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|