C23H22ClN3O5S — CID 27569068
N-(2-chlorophenyl)-4-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 27569068) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-4-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27569068 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-(2-chlorophenyl)-4-[[[2-(2,5-dimethylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2ccc(S(=O)(=O)Nc3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C23H22ClN3O5S/c1-15-7-8-16(2)21(13-15)32-14-22(28)25-26-23(29)17-9-11-18(12-10-17)33(30,31)27-20-6-4-3-5-19(20)24/h3-13,27H,14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | NRTITVSPBIZRSM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|