C16H17FN2O4S — CID 8614158
2-(2,5-dimethylphenoxy)-N'-(3-fluorophenyl)sulfonylacetohydrazide (PubChem CID 8614158) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N'-(3-fluorophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N'-(3-fluorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8614158 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N'-(3-fluorophenyl)sulfonylacetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNS(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H17FN2O4S/c1-11-6-7-12(2)15(8-11)23-10-16(20)18-19-24(21,22)14-5-3-4-13(17)9-14/h3-9,19H,10H2,1-2H3,(H,18,20) |
| InChIKey | OCMLGTSLPWZVOI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|