C23H29N3O6S — CID 25485174
3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N'-[2-(2,5-dimethylphenoxy)acetyl]benzohydrazide (PubChem CID 25485174) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N'-[2-(2,5-dimethylphenoxy)acetyl]benzohydrazide.
| Compound Name | 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N'-[2-(2,5-dimethylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25485174 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N'-[2-(2,5-dimethylphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2cccc(S(=O)(=O)N3C[C@H](C)O[C@@H](C)C3)c2)c1 |
| InChI | InChI=1S/C23H29N3O6S/c1-15-8-9-16(2)21(10-15)31-14-22(27)24-25-23(28)19-6-5-7-20(11-19)33(29,30)26-12-17(3)32-18(4)13-26/h5-11,17-18H,12-14H2,1-4H3,(H,24,27)(H,25,28)/t17-,18-/m0/s1 |
| InChIKey | HZGUEIVXWUBLPL-ROUUACIJSA-N |
| XLogP | 1.94 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|