C19H22N2O5S — CID 119235246
5-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]pentanoic acid (PubChem CID 119235246) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 5-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119235246 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NCCCCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-14-8-10-16(11-9-14)21-27(25,26)17-6-4-5-15(13-17)19(24)20-12-3-2-7-18(22)23/h4-6,8-11,13,21H,2-3,7,12H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | XPOHBZAKEXLAMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|