C17H19N3O4S2 — CID 31469976
N-[3-[[[2-(4-methylphenyl)sulfanylacetyl]amino]carbamoyl]phenyl]methanesulfonamide (PubChem CID 31469976) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[3-[[[2-(4-methylphenyl)sulfanylacetyl]amino]carbamoyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[[2-(4-methylphenyl)sulfanylacetyl]amino]carbamoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 31469976 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[3-[[[2-(4-methylphenyl)sulfanylacetyl]amino]carbamoyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(SCC(=O)NNC(=O)c2cccc(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-12-6-8-15(9-7-12)25-11-16(21)18-19-17(22)13-4-3-5-14(10-13)20-26(2,23)24/h3-10,20H,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | MSMHSTHJPWELBU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|