C19H22N2O5S2 — CID 16562317
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(methanesulfonamido)benzoate (PubChem CID 16562317) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(methanesulfonamido)benzoate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16562317 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)c2cccc(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-14-6-8-17(9-7-14)27-11-10-20-18(22)13-26-19(23)15-4-3-5-16(12-15)21-28(2,24)25/h3-9,12,21H,10-11,13H2,1-2H3,(H,20,22) |
| InChIKey | LSXYPWSAOYZBSC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|