C21H25N3O5S — CID 46467570
N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 46467570) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46467570 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-14-3-8-17(23-20(25)15-4-5-15)13-19(14)24-21(26)16-6-9-18(10-7-16)30(27,28)22-11-12-29-2/h3,6-10,13,15,22H,4-5,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | KIADXULXIVNMGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|