C19H20N2O4S — CID 55711603
N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-3-methylsulfonylbenzamide (PubChem CID 55711603) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55711603 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]-3-methylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-12-6-9-15(20-18(22)13-7-8-13)11-17(12)21-19(23)14-4-3-5-16(10-14)26(2,24)25/h3-6,9-11,13H,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HVQARGAGVBWQNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |