C24H28N2O2 — CID 46478092
4-cyclohexyl-N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]benzamide (PubChem CID 46478092) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-cyclohexyl-N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 46478092 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-cyclohexyl-N-[5-(cyclopropanecarbonylamino)-2-methylphenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-16-7-14-21(25-23(27)19-12-13-19)15-22(16)26-24(28)20-10-8-18(9-11-20)17-5-3-2-4-6-17/h7-11,14-15,17,19H,2-6,12-13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | MLTDIQRIXWXEDZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |