C12H12F2N2O5 — CID 61185302
3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylamino]butanoic acid (PubChem CID 61185302) has the molecular formula C12H12F2N2O5 and a molecular weight of 302.23 g/mol. Its IUPAC name is 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylamino]butanoic acid.
| Compound Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 61185302 |
| Molecular Formula | C12H12F2N2O5 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H12F2N2O5/c1-6(4-10(17)18)15-11(19)16-7-2-3-8-9(5-7)21-12(13,14)20-8/h2-3,5-6H,4H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | DONOAEYTZIOXFS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |