C13H14N2O3S — CID 65453593
3-(1-benzothiophen-5-ylcarbamoylamino)butanoic acid (PubChem CID 65453593) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-(1-benzothiophen-5-ylcarbamoylamino)butanoic acid.
| Compound Name | 3-(1-benzothiophen-5-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 65453593 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(1-benzothiophen-5-ylcarbamoylamino)butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-8(6-12(16)17)14-13(18)15-10-2-3-11-9(7-10)4-5-19-11/h2-5,7-8H,6H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | PYXUIYNRKFHFJP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |