C13H13F2NO4 — CID 94208875
(2R)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-prop-2-enoxypropanamide (PubChem CID 94208875) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is (2R)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-prop-2-enoxypropanamide.
| Compound Name | (2R)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 94208875 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2R)-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@H](C)C(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H13F2NO4/c1-3-6-18-8(2)12(17)16-9-4-5-10-11(7-9)20-13(14,15)19-10/h3-5,7-8H,1,6H2,2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | DMDBGMZUQLNXEU-MRVPVSSYSA-N |
| XLogP | 2.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|