C14H18F2N2O3 — CID 43113642
N-butyl-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide (PubChem CID 43113642) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-butyl-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide.
| Compound Name | N-butyl-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide |
|---|---|
| PubChem CID | 43113642 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-butyl-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide |
| SMILES | CCCCNC(=O)C(C)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C14H18F2N2O3/c1-3-4-7-17-13(19)9(2)18-10-5-6-11-12(8-10)21-14(15,16)20-11/h5-6,8-9,18H,3-4,7H2,1-2H3,(H,17,19) |
| InChIKey | PABVEYZPOVLQCU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|