C16H19F2N3O4 — CID 55432296
N-(cyclopentylcarbamoyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide (PubChem CID 55432296) has the molecular formula C16H19F2N3O4 and a molecular weight of 355.34 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide |
|---|---|
| PubChem CID | 55432296 |
| Molecular Formula | C16H19F2N3O4 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]propanamide |
| SMILES | CC(Nc1ccc2c(c1)OC(F)(F)O2)C(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H19F2N3O4/c1-9(14(22)21-15(23)20-10-4-2-3-5-10)19-11-6-7-12-13(8-11)25-16(17,18)24-12/h6-10,19H,2-5H2,1H3,(H2,20,21,22,23) |
| InChIKey | CJZBWXOWUSCVTQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|