C17H23N3O4 — CID 35644241
(2S)-N-(methylcarbamoyl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide (PubChem CID 35644241) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2S)-N-(methylcarbamoyl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide.
| Compound Name | (2S)-N-(methylcarbamoyl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide |
|---|---|
| PubChem CID | 35644241 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-N-(methylcarbamoyl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide |
| SMILES | CNC(=O)NC(=O)[C@H](C)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C17H23N3O4/c1-11(15(21)20-16(22)18-2)19-12-6-7-13-14(10-12)24-17(23-13)8-4-3-5-9-17/h6-7,10-11,19H,3-5,8-9H2,1-2H3,(H2,18,20,21,22)/t11-/m0/s1 |
| InChIKey | MCYIISLSORBGCE-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|