C20H22N2O3 — CID 35644639
(2S)-2-phenyl-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)acetamide (PubChem CID 35644639) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2S)-2-phenyl-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)acetamide.
| Compound Name | (2S)-2-phenyl-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)acetamide |
|---|---|
| PubChem CID | 35644639 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S)-2-phenyl-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)acetamide |
| SMILES | NC(=O)[C@@H](Nc1ccc2c(c1)OC1(CCCCC1)O2)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c21-19(23)18(14-7-3-1-4-8-14)22-15-9-10-16-17(13-15)25-20(24-16)11-5-2-6-12-20/h1,3-4,7-10,13,18,22H,2,5-6,11-12H2,(H2,21,23)/t18-/m0/s1 |
| InChIKey | XVMIGNOYJXDEMS-SFHVURJKSA-N |
| XLogP | 3.76 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|