C22H24N2O5 — CID 55598967
N-(1,3-benzodioxol-5-yl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide (PubChem CID 55598967) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide |
|---|---|
| PubChem CID | 55598967 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)propanamide |
| SMILES | CC(Nc1ccc2c(c1)OC1(CCCCC1)O2)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N2O5/c1-14(21(25)24-16-5-7-17-19(11-16)27-13-26-17)23-15-6-8-18-20(12-15)29-22(28-18)9-3-2-4-10-22/h5-8,11-12,14,23H,2-4,9-10,13H2,1H3,(H,24,25) |
| InChIKey | IRJRBQZHKYGSKH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|