C14H15ClFNO3 — CID 166428021
2-chloro-2-fluoro-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetamide (PubChem CID 166428021) has the molecular formula C14H15ClFNO3 and a molecular weight of 299.73 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetamide.
| Compound Name | 2-chloro-2-fluoro-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetamide |
|---|---|
| PubChem CID | 166428021 |
| Molecular Formula | C14H15ClFNO3 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-chloro-2-fluoro-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCCC1)O2)C(F)Cl |
| InChI | InChI=1S/C14H15ClFNO3/c15-12(16)13(18)17-9-4-5-10-11(8-9)20-14(19-10)6-2-1-3-7-14/h4-5,8,12H,1-3,6-7H2,(H,17,18) |
| InChIKey | VFLUTHRYRHUTCA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|