C27H28O8 — CID 90978245
3-[3-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)-2-phenylpropylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 90978245) has the molecular formula C27H28O8 and a molecular weight of 480.51 g/mol. Its IUPAC name is 3-[3-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)-2-phenylpropylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[3-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)-2-phenylpropylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 90978245 |
| Molecular Formula | C27H28O8 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 3-[3-(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)-2-phenylpropylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1=CC(C=C1C(=O)OC2(CCCCC2)OC1=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O8/c28-22-20(23(29)33-26(32-22)12-6-2-7-13-26)16-19(18-10-4-1-5-11-18)17-21-24(30)34-27(35-25(21)31)14-8-3-9-15-27/h1,4-5,10-11,16-17,19H,2-3,6-9,12-15H2 |
| InChIKey | HSFZHGAZNLGITR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|