C11H14O4 — CID 139694670
3-methylidene-1,5-dioxaspiro[5.6]dodecane-2,4-dione (PubChem CID 139694670) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-methylidene-1,5-dioxaspiro[5.6]dodecane-2,4-dione.
| Compound Name | 3-methylidene-1,5-dioxaspiro[5.6]dodecane-2,4-dione |
|---|---|
| PubChem CID | 139694670 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-methylidene-1,5-dioxaspiro[5.6]dodecane-2,4-dione |
| SMILES | C=C1C(=O)OC2(CCCCCC2)OC1=O |
| InChI | InChI=1S/C11H14O4/c1-8-9(12)14-11(15-10(8)13)6-4-2-3-5-7-11/h1-7H2 |
| InChIKey | LZQUYZMDUGYTOM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|