C16H18O3 — CID 139662377
2-methyl-3-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 139662377) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | 2-methyl-3-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 139662377 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-methyl-3-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)OC2(CCCCC2)O1 |
| InChI | InChI=1S/C16H18O3/c1-12-14(13-8-4-2-5-9-13)15(17)19-16(18-12)10-6-3-7-11-16/h2,4-5,8-9H,3,6-7,10-11H2,1H3 |
| InChIKey | ZHXQQMHZKQGXIQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |