C10H12O4 — CID 21058291
3-methylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 21058291) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-methylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-methylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 21058291 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-methylidene-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | C=C1C(=O)OC2(CCCCC2)OC1=O |
| InChI | InChI=1S/C10H12O4/c1-7-8(11)13-10(14-9(7)12)5-3-2-4-6-10/h1-6H2 |
| InChIKey | KCYJHAMSDGRXOF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|