C18H18F2N2O4 — CID 37304550
(2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(2-ethoxyphenyl)propanamide (PubChem CID 37304550) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is (2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(2-ethoxyphenyl)propanamide.
| Compound Name | (2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(2-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 37304550 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(2-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](C)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C18H18F2N2O4/c1-3-24-14-7-5-4-6-13(14)22-17(23)11(2)21-12-8-9-15-16(10-12)26-18(19,20)25-15/h4-11,21H,3H2,1-2H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | UACLCNNSQNPIIT-NSHDSACASA-N |
| XLogP | 3.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|