C14H20N2O3 — CID 47223959
3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-1,1-diethylurea (PubChem CID 47223959) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-1,1-diethylurea.
| Compound Name | 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 47223959 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-benzodioxol-5-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C14H20N2O3/c1-5-16(6-2)13(17)15-10-7-8-11-12(9-10)19-14(3,4)18-11/h7-9H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | YQLVNRVXRUQQRK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |