C21H24N2O3 — CID 47032879
1-benzyl-1-ethyl-3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylurea (PubChem CID 47032879) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-benzyl-1-ethyl-3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylurea.
| Compound Name | 1-benzyl-1-ethyl-3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylurea |
|---|---|
| PubChem CID | 47032879 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-benzyl-1-ethyl-3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylurea |
| SMILES | CCN(Cc1ccccc1)C(=O)Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C21H24N2O3/c1-2-23(15-16-8-4-3-5-9-16)20(24)22-17-10-11-18-19(14-17)26-21(25-18)12-6-7-13-21/h3-5,8-11,14H,2,6-7,12-13,15H2,1H3,(H,22,24) |
| InChIKey | JBNZXSSJGIPRLS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |