C22H24N2O4 — CID 108976596
1-N'-benzyl-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide (PubChem CID 108976596) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-N'-benzyl-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-benzyl-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976596 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-N'-benzyl-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N'-ethylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1(C(=O)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-24(15-16-6-4-3-5-7-16)21(26)22(10-11-22)20(25)23-17-8-9-18-19(14-17)28-13-12-27-18/h3-9,14H,2,10-13,15H2,1H3,(H,23,25) |
| InChIKey | QUUSFIJLJLFJAG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|