C22H25N3O3 — CID 108976586
1-N-(3-acetamidophenyl)-1-N'-benzyl-1-N'-ethylcyclopropane-1,1-dicarboxamide (PubChem CID 108976586) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-N-(3-acetamidophenyl)-1-N'-benzyl-1-N'-ethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-acetamidophenyl)-1-N'-benzyl-1-N'-ethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976586 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-N-(3-acetamidophenyl)-1-N'-benzyl-1-N'-ethylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1(C(=O)Nc2cccc(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C22H25N3O3/c1-3-25(15-17-8-5-4-6-9-17)21(28)22(12-13-22)20(27)24-19-11-7-10-18(14-19)23-16(2)26/h4-11,14H,3,12-13,15H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | NAEAPUNUWFFODT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|