C21H21N3O4 — CID 108983396
1-N'-(3-acetamidophenyl)-1-N-(3-acetylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108983396) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-N'-(3-acetamidophenyl)-1-N-(3-acetylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-acetamidophenyl)-1-N-(3-acetylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108983396 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-N'-(3-acetamidophenyl)-1-N-(3-acetylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C2(C(=O)Nc3cccc(C(C)=O)c3)CC2)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-13(25)15-5-3-6-16(11-15)23-19(27)21(9-10-21)20(28)24-18-8-4-7-17(12-18)22-14(2)26/h3-8,11-12H,9-10H2,1-2H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | ADHDBYRTECJEJF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|