C20H20N2O4 — CID 108980795
methyl 3-[[1-[(3-methylphenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 108980795) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 3-[[1-[(3-methylphenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-[(3-methylphenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108980795 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl 3-[[1-[(3-methylphenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C2(C(=O)Nc3cccc(C)c3)CC2)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-13-5-3-7-15(11-13)21-18(24)20(9-10-20)19(25)22-16-8-4-6-14(12-16)17(23)26-2/h3-8,11-12H,9-10H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | PCVUFVVUNJGUAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|